mcncoin.info
Open in
urlscan Pro
66.94.115.253
Public Scan
Submitted URL: http://mcncoin.info/?shiny
Effective URL: https://mcncoin.info/?shiny
Submission Tags: shiny c290acadafe6362a fc6b18fd85158e2b bfst honeypoter@gmail.com Search All
Submission: On September 03 via api from JP — Scanned from JP
Effective URL: https://mcncoin.info/?shiny
Submission Tags: shiny c290acadafe6362a fc6b18fd85158e2b bfst honeypoter@gmail.com Search All
Submission: On September 03 via api from JP — Scanned from JP
Form analysis
0 forms found in the DOMText Content
Skip to content * Bitcoin(BTC)$57,892.00-2.32% * Ethereum(ETH)$2,456.78-3.47% * Tether(USDT)$1.00-0.11% * BNB(BNB)$523.74-0.80% * Solana(SOL)$129.63-3.84% * USDC(USDC)$1.00-0.09% * XRP(XRP)$0.56-0.61% * Lido Staked Ether(STETH)$2,456.17-3.45% * Dogecoin(DOGE)$0.097650-1.44% * TRON(TRX)$0.150831-2.16% * Toncoin(TON)$4.95-5.15% * Cardano(ADA)$0.322088-4.40% * Wrapped stETH(WSTETH)$2,893.77-3.43% * Wrapped Bitcoin(WBTC)$57,851.00-2.20% * Avalanche(AVAX)$21.55-4.05% * Shiba Inu(SHIB)$0.000013-3.27% * WETH(WETH)$2,457.11-3.46% * Chainlink(LINK)$10.38-3.55% * Bitcoin Cash(BCH)$312.39-3.58% * Polkadot(DOT)$4.11-2.43% * LEO Token(LEO)$5.85-0.72% * Dai(DAI)$1.00-0.06% * Litecoin(LTC)$65.00-0.66% * Uniswap(UNI)$6.12-1.38% * NEAR Protocol(NEAR)$3.78-5.55% * Wrapped eETH(WEETH)$2,570.31-3.57% * Kaspa(KAS)$0.156536-3.25% * Polygon(MATIC)$0.402428-2.27% * Internet Computer(ICP)$7.25-3.52% * Monero(XMR)$174.653.32% * Pepe(PEPE)$0.000007-3.63% * Aptos(APT)$6.15-3.64% * Artificial Superintelligence Alliance(FET)$1.13-7.54% * First Digital USD(FDUSD)$1.00-0.33% * Stellar(XLM)$0.091915-0.62% * Ethena USDe(USDE)$1.000.00% * Ethereum Classic(ETC)$17.80-2.76% * OKB(OKB)$36.25-1.59% * Sui(SUI)$0.812.74% * Stacks(STX)$1.44-4.81% * Cronos(CRO)$0.078987-2.00% * Filecoin(FIL)$3.39-3.04% * Mantle(MNT)$0.58-3.45% * Bittensor(TAO)$257.71-8.51% * Render(RENDER)$4.80-6.18% * Immutable(IMX)$1.18-7.63% * Aave(AAVE)$123.27-7.73% * Hedera(HBAR)$0.049098-3.28% * Arbitrum(ARB)$0.499695-3.56% * VeChain(VET)$0.021055-3.32% * Cosmos Hub(ATOM)$4.16-6.45% * Optimism(OP)$1.36-3.58% * Injective(INJ)$16.25-5.63% * Maker(MKR)$1,689.28-4.28% * WhiteBIT Coin(WBT)$10.86-0.15% * dogwifhat(WIF)$1.51-2.21% * Binance-Peg WETH(WETH)$2,456.63-3.59% * Arweave(AR)$20.76-4.65% * Bitget Token(BGB)$0.97-0.32% * Rocket Pool ETH(RETH)$2,750.73-3.64% * The Graph(GRT)$0.137508-5.87% * THORChain(RUNE)$3.92-0.57% * Mantle Staked Ether(METH)$2,559.29-3.54% * Helium(HNT)$7.06-7.22% * Bonk(BONK)$0.000017-3.62% * FLOKI(FLOKI)$0.000120-1.76% * Theta Network(THETA)$1.15-3.87% * Fantom(FTM)$0.396787-7.45% * Solv Protocol SolvBTC(SOLVBTC)$57,766.00-2.24% * Algorand(ALGO)$0.120891-3.71% * Gate(GT)$7.45-0.22% * KuCoin(KCS)$8.24-1.73% * Jupiter(JUP)$0.72-3.88% * Pyth Network(PYTH)$0.263015-3.76% * Renzo Restaked ETH(EZETH)$2,497.39-3.66% * PayPal USD(PYUSD)$1.000.02% * Lido DAO(LDO)$1.01-6.50% * JasmyCoin(JASMY)$0.018410-2.93% * Quant(QNT)$61.28-1.77% * Ronin Bridged WETH (Ronin)(WETH)$2,456.68-3.67% * Sei(SEI)$0.266959-6.22% * Bitcoin SV(BSV)$44.122.31% * Celestia(TIA)$4.15-7.94% * Ondo(ONDO)$0.59-5.17% * Flow(FLOW)$0.56-1.90% * ether.fi Staked ETH(EETH)$2,460.35-3.25% * Fasttoken(FTN)$2.520.13% * MANTRA(OM)$0.97-2.74% * Notcoin(NOT)$0.007948-5.98% * Core(CORE)$0.89-3.44% * BitTorrent(BTT)$0.000001-2.72% * Klaytn(KLAY)$0.131509-4.64% * USDD(USDD)$1.000.10% * MultiversX(EGLD)$26.80-5.01% * Flare(FLR)$0.015221-3.85% * EOS(EOS)$0.459284-3.54% * Brett(BRETT)$0.069590-9.49% * GALA(GALA)$0.017793-4.05% * Axie Infinity(AXS)$4.51-3.72% * NEO(NEO)$9.48-2.80% * Tokenize Xchange(TKX)$8.30-3.94% * ORDI(ORDI)$31.22-0.12% * Starknet(STRK)$0.366819-3.31% * Frax(FRAX)$1.00-0.08% * Beam(BEAM)$0.012595-6.38% * Marinade Staked SOL(MSOL)$157.41-3.70% * Kelp DAO Restaked ETH(RSETH)$2,509.58-3.77% * Tezos(XTZ)$0.63-4.48% * SATS (Ordinals)(SATS)$0.000000-4.43% * Tether Gold(XAUT)$2,494.70-0.16% * Arbitrum Bridged WBTC (Arbitrum One)(WBTC)$57,867.00-2.05% * eCash(XEC)$0.000030-1.70% * Worldcoin(WLD)$1.42-3.99% * The Sandbox(SAND)$0.244563-2.94% * Akash Network(AKT)$2.29-6.57% * Arbitrum Bridged WETH (Arbitrum One)(WETH)$2,456.42-3.54% * Ethereum Name Service(ENS)$16.86-5.02% * NEXO(NEXO)$0.98-2.48% * Conflux(CFX)$0.126135-4.26% * dYdX(DYDX)$0.88-3.39% * Popcat(POPCAT)$0.55-10.07% * Dogs(DOGS)$0.001030-11.67% * Ronin(RON)$1.51-5.16% * Wormhole(W)$0.200223-5.69% * Coinbase Wrapped Staked ETH(CBETH)$2,649.39-3.50% * TrueUSD(TUSD)$1.00-0.11% * Mina Protocol(MINA)$0.417823-5.21% * Decentraland(MANA)$0.257544-3.02% * PAX Gold(PAXG)$2,495.38-0.17% * L2 Standard Bridged WETH (Blast)(WETH)$2,467.90-2.62% * Pendle(PENDLE)$2.91-9.09% * Chiliz(CHZ)$0.050856-3.10% * Frax Ether(FRXETH)$2,450.25-3.54% * APENFT(NFT)$0.000000-8.51% * PancakeSwap(CAKE)$1.69-3.03% * Zcash(ZEC)$29.19-1.27% * Terra Luna Classic(LUNC)$0.000076-2.53% * AIOZ Network(AIOZ)$0.384239-5.64% * DeXe(DEXE)$7.48-1.63% * Synthetix Network(SNX)$1.30-2.64% * Ethena(ENA)$0.222693-6.80% * IOTA(IOTA)$0.123115-4.08% * Astar(ASTR)$0.058278-5.04% * USDB(USDB)$1.010.86% * Axelar(AXL)$0.53-1.36% * Livepeer(LPT)$11.85-6.29% * BOOK OF MEME(BOME)$0.005868-3.18% * ApeCoin(APE)$0.59-1.56% * XDC Network(XDC)$0.026105-0.19% * Raydium(RAY)$1.46-4.20% * Gnosis(GNO)$147.63-1.30% * LayerZero(ZRO)$3.39-11.07% * Bridged USDC (Polygon PoS Bridge)(USDC.E)$1.00-0.12% * Compound(COMP)$43.37-4.12% * SafePal(SFP)$0.771.30% * Bitcoin Gold(BTG)$21.39-2.38% * Polygon PoS Bridged WETH (Polygon POS)(WETH)$2,455.83-3.50% * Binance-Peg BUSD(BUSD)$1.00-0.36% * ZKsync(ZK)$0.099832-6.24% * Safe(SAFE)$0.76-3.46% * Nervos Network(CKB)$0.008070-2.56% * Staked Frax Ether(SFRXETH)$2,689.83-2.76% * MX(MX)$3.68-0.05% * L2 Standard Bridged WETH (Base)(WETH)$2,457.02-3.45% * Oasis Network(ROSE)$0.053043-4.46% * Theta Fuel(TFUEL)$0.053315-5.36% * cat in a dogs world(MEW)$0.004002-4.72% * Swell Ethereum(SWETH)$2,618.43-3.54% * WEMIX(WEMIX)$0.87-0.10% * Beldex(BDX)$0.0521210.61% * Trust Wallet(TWT)$0.82-2.43% * Ondo US Dollar Yield(USDY)$1.05-0.38% * Aerodrome Finance(AERO)$0.55-4.06% * Mog Coin(MOG)$0.000001-5.82% * IoTeX(IOTX)$0.033927-2.73% * Echelon Prime(PRIME)$6.93-3.54% * Kava(KAVA)$0.293124-3.82% * Curve DAO(CRV)$0.263550-6.11% * Bitcoin Avalanche Bridged (BTC.b)(BTC.B)$57,975.00-2.04% * Amp(AMP)$0.003769-3.61% * ConstitutionDAO(PEOPLE)$0.058816-6.01% * SuperVerse(SUPER)$0.66-9.45% * Stader ETHx(ETHX)$2,551.54-3.51% * Sun Token(SUN)$0.029886-6.75% * Dash(DASH)$24.422.50% * JUST(JST)$0.028857-3.96% * 1inch(1INCH)$0.225673-4.39% * Blur(BLUR)$0.151448-2.11% * Holo(HOT)$0.001567-2.76% * PepeCoin(PEPECOIN)$2.34-4.11% * Aevo(AEVO)$0.312952-4.98% * Kusama(KSM)$17.65-4.12% * Golem(GLM)$0.271877-2.74% * WOO(WOO)$0.141050-6.16% * GMT(GMT)$0.113377-3.10% * Jito(JTO)$2.13-3.22% * Galxe(GAL)$2.08-2.06% * aelf(ELF)$0.363947-3.82% * SingularityNET(AGIX)$0.51-3.71% * Osmosis(OSMO)$0.380562-4.55% * DOG•GO•TO•THE•MOON (Runes)(DOG)$0.002583-8.44% * Arkham(ARKM)$0.98-6.18% * Reserve Rights(RSR)$0.005001-5.87% * Metaplex(MPLX)$0.259372-5.48% * Zilliqa(ZIL)$0.013272-2.00% * Aragon(ANT)$6.25-1.46% * Sundog(SUNDOG)$0.249698-1.97% * Illuvium(ILV)$36.45-4.34% * GMX(GMX)$25.40-3.04% * cWBTC(CWBTC)$1,162.57-2.01% * Venom(VENOM)$0.133300-2.66% * Dymension(DYM)$1.21-6.65% * Turbo(TURBO)$0.003505-3.82% * Basic Attention(BAT)$0.160175-3.12% * 0x Protocol(ZRX)$0.282449-3.57% * Gravity(G)$0.033083-6.98% * Radix(XRD)$0.022696-2.21% * Siacoin(SC)$0.004107-3.10% * Arbitrum Bridged USDC (Arbitrum)(USDC.E)$1.00-0.11% * Ankr Network(ANKR)$0.023473-2.91% * Terra(LUNA)$0.340719-0.41% * Memecoin(MEME)$0.009224-5.76% * Celo(CELO)$0.425758-5.32% * Manta Network(MANTA)$0.62-6.08% * Polygon Bridged WBTC (Polygon POS)(WBTC)$57,851.00-2.14% * Enjin Coin(ENJ)$0.136700-0.96% * Olympus(OHM)$14.310.05% * Qtum(QTUM)$2.19-2.94% * QuantixAI(QAI)$71.85-2.21% * OUSG(OUSG)$107.820.04% * Lombard Staked BTC(LBTC)$57,866.00-2.33% * Rocket Pool(RPL)$10.97-2.30% * Ravencoin(RVN)$0.015613-3.78% * Ether.fi(ETHFI)$1.27-4.93% * Polymesh(POLYX)$0.203657-4.13% * Flux(FLUX)$0.6315.01% * Liquid Staked ETH(LSETH)$2,593.27-3.07% * Tribe(TRIBE)$0.4765033.39% * Avail(AVAIL)$0.1236232.80% * Usual USD(USD0)$1.00-0.05% * Mask Network(MASK)$2.12-5.97% * CorgiAI(CORGIAI)$0.0006161.56% * MMX(MMX)$1.45-1.28% * Quorium(QGOLD)$2,501.34-0.30% * Ultima(ULTIMA)$6,819.623.25% * Gas(GAS)$3.16-2.99% * OriginTrail(TRAC)$0.50-3.01% * Nexus Mutual(NXM)$57.103.19% * Osaka Protocol(OSAK)$0.00000011.51% * Threshold Network(T)$0.020458-4.45% * Bitcoin(BTC)$57,892.00-2.32% * Ethereum(ETH)$2,456.78-3.47% * Tether(USDT)$1.00-0.11% * BNB(BNB)$523.74-0.80% * Solana(SOL)$129.63-3.84% * USDC(USDC)$1.00-0.09% * XRP(XRP)$0.56-0.61% * Lido Staked Ether(STETH)$2,456.17-3.45% * Dogecoin(DOGE)$0.097650-1.44% * TRON(TRX)$0.150831-2.16% * Toncoin(TON)$4.95-5.15% * Cardano(ADA)$0.322088-4.40% * Wrapped stETH(WSTETH)$2,893.77-3.43% * Wrapped Bitcoin(WBTC)$57,851.00-2.20% * Avalanche(AVAX)$21.55-4.05% * Shiba Inu(SHIB)$0.000013-3.27% * WETH(WETH)$2,457.11-3.46% * Chainlink(LINK)$10.38-3.55% * Bitcoin Cash(BCH)$312.39-3.58% * Polkadot(DOT)$4.11-2.43% * LEO Token(LEO)$5.85-0.72% * Dai(DAI)$1.00-0.06% * Litecoin(LTC)$65.00-0.66% * Uniswap(UNI)$6.12-1.38% * NEAR Protocol(NEAR)$3.78-5.55% * Wrapped eETH(WEETH)$2,570.31-3.57% * Kaspa(KAS)$0.156536-3.25% * Polygon(MATIC)$0.402428-2.27% * Internet Computer(ICP)$7.25-3.52% * Monero(XMR)$174.653.32% * Pepe(PEPE)$0.000007-3.63% * Aptos(APT)$6.15-3.64% * Artificial Superintelligence Alliance(FET)$1.13-7.54% * First Digital USD(FDUSD)$1.00-0.33% * Stellar(XLM)$0.091915-0.62% * Ethena USDe(USDE)$1.000.00% * Ethereum Classic(ETC)$17.80-2.76% * OKB(OKB)$36.25-1.59% * Sui(SUI)$0.812.74% * Stacks(STX)$1.44-4.81% * Cronos(CRO)$0.078987-2.00% * Filecoin(FIL)$3.39-3.04% * Mantle(MNT)$0.58-3.45% * Bittensor(TAO)$257.71-8.51% * Render(RENDER)$4.80-6.18% * Immutable(IMX)$1.18-7.63% * Aave(AAVE)$123.27-7.73% * Hedera(HBAR)$0.049098-3.28% * Arbitrum(ARB)$0.499695-3.56% * VeChain(VET)$0.021055-3.32% * Cosmos Hub(ATOM)$4.16-6.45% * Optimism(OP)$1.36-3.58% * Injective(INJ)$16.25-5.63% * Maker(MKR)$1,689.28-4.28% * WhiteBIT Coin(WBT)$10.86-0.15% * dogwifhat(WIF)$1.51-2.21% * Binance-Peg WETH(WETH)$2,456.63-3.59% * Arweave(AR)$20.76-4.65% * Bitget Token(BGB)$0.97-0.32% * Rocket Pool ETH(RETH)$2,750.73-3.64% * The Graph(GRT)$0.137508-5.87% * THORChain(RUNE)$3.92-0.57% * Mantle Staked Ether(METH)$2,559.29-3.54% * Helium(HNT)$7.06-7.22% * Bonk(BONK)$0.000017-3.62% * FLOKI(FLOKI)$0.000120-1.76% * Theta Network(THETA)$1.15-3.87% * Fantom(FTM)$0.396787-7.45% * Solv Protocol SolvBTC(SOLVBTC)$57,766.00-2.24% * Algorand(ALGO)$0.120891-3.71% * Gate(GT)$7.45-0.22% * KuCoin(KCS)$8.24-1.73% * Jupiter(JUP)$0.72-3.88% * Pyth Network(PYTH)$0.263015-3.76% * Renzo Restaked ETH(EZETH)$2,497.39-3.66% * PayPal USD(PYUSD)$1.000.02% * Lido DAO(LDO)$1.01-6.50% * JasmyCoin(JASMY)$0.018410-2.93% * Quant(QNT)$61.28-1.77% * Ronin Bridged WETH (Ronin)(WETH)$2,456.68-3.67% * Sei(SEI)$0.266959-6.22% * Bitcoin SV(BSV)$44.122.31% * Celestia(TIA)$4.15-7.94% * Ondo(ONDO)$0.59-5.17% * Flow(FLOW)$0.56-1.90% * ether.fi Staked ETH(EETH)$2,460.35-3.25% * Fasttoken(FTN)$2.520.13% * MANTRA(OM)$0.97-2.74% * Notcoin(NOT)$0.007948-5.98% * Core(CORE)$0.89-3.44% * BitTorrent(BTT)$0.000001-2.72% * Klaytn(KLAY)$0.131509-4.64% * USDD(USDD)$1.000.10% * MultiversX(EGLD)$26.80-5.01% * Flare(FLR)$0.015221-3.85% * EOS(EOS)$0.459284-3.54% * Brett(BRETT)$0.069590-9.49% * GALA(GALA)$0.017793-4.05% * Axie Infinity(AXS)$4.51-3.72% * NEO(NEO)$9.48-2.80% * Tokenize Xchange(TKX)$8.30-3.94% * ORDI(ORDI)$31.22-0.12% * Starknet(STRK)$0.366819-3.31% * Frax(FRAX)$1.00-0.08% * Beam(BEAM)$0.012595-6.38% * Marinade Staked SOL(MSOL)$157.41-3.70% * Kelp DAO Restaked ETH(RSETH)$2,509.58-3.77% * Tezos(XTZ)$0.63-4.48% * SATS (Ordinals)(SATS)$0.000000-4.43% * Tether Gold(XAUT)$2,494.70-0.16% * Arbitrum Bridged WBTC (Arbitrum One)(WBTC)$57,867.00-2.05% * eCash(XEC)$0.000030-1.70% * Worldcoin(WLD)$1.42-3.99% * The Sandbox(SAND)$0.244563-2.94% * Akash Network(AKT)$2.29-6.57% * Arbitrum Bridged WETH (Arbitrum One)(WETH)$2,456.42-3.54% * Ethereum Name Service(ENS)$16.86-5.02% * NEXO(NEXO)$0.98-2.48% * Conflux(CFX)$0.126135-4.26% * dYdX(DYDX)$0.88-3.39% * Popcat(POPCAT)$0.55-10.07% * Dogs(DOGS)$0.001030-11.67% * Ronin(RON)$1.51-5.16% * Wormhole(W)$0.200223-5.69% * Coinbase Wrapped Staked ETH(CBETH)$2,649.39-3.50% * TrueUSD(TUSD)$1.00-0.11% * Mina Protocol(MINA)$0.417823-5.21% * Decentraland(MANA)$0.257544-3.02% * PAX Gold(PAXG)$2,495.38-0.17% * L2 Standard Bridged WETH (Blast)(WETH)$2,467.90-2.62% * Pendle(PENDLE)$2.91-9.09% * Chiliz(CHZ)$0.050856-3.10% * Frax Ether(FRXETH)$2,450.25-3.54% * APENFT(NFT)$0.000000-8.51% * PancakeSwap(CAKE)$1.69-3.03% * Zcash(ZEC)$29.19-1.27% * Terra Luna Classic(LUNC)$0.000076-2.53% * AIOZ Network(AIOZ)$0.384239-5.64% * DeXe(DEXE)$7.48-1.63% * Synthetix Network(SNX)$1.30-2.64% * Ethena(ENA)$0.222693-6.80% * IOTA(IOTA)$0.123115-4.08% * Astar(ASTR)$0.058278-5.04% * USDB(USDB)$1.010.86% * Axelar(AXL)$0.53-1.36% * Livepeer(LPT)$11.85-6.29% * BOOK OF MEME(BOME)$0.005868-3.18% * ApeCoin(APE)$0.59-1.56% * XDC Network(XDC)$0.026105-0.19% * Raydium(RAY)$1.46-4.20% * Gnosis(GNO)$147.63-1.30% * LayerZero(ZRO)$3.39-11.07% * Bridged USDC (Polygon PoS Bridge)(USDC.E)$1.00-0.12% * Compound(COMP)$43.37-4.12% * SafePal(SFP)$0.771.30% * Bitcoin Gold(BTG)$21.39-2.38% * Polygon PoS Bridged WETH (Polygon POS)(WETH)$2,455.83-3.50% * Binance-Peg BUSD(BUSD)$1.00-0.36% * ZKsync(ZK)$0.099832-6.24% * Safe(SAFE)$0.76-3.46% * Nervos Network(CKB)$0.008070-2.56% * Staked Frax Ether(SFRXETH)$2,689.83-2.76% * MX(MX)$3.68-0.05% * L2 Standard Bridged WETH (Base)(WETH)$2,457.02-3.45% * Oasis Network(ROSE)$0.053043-4.46% * Theta Fuel(TFUEL)$0.053315-5.36% * cat in a dogs world(MEW)$0.004002-4.72% * Swell Ethereum(SWETH)$2,618.43-3.54% * WEMIX(WEMIX)$0.87-0.10% * Beldex(BDX)$0.0521210.61% * Trust Wallet(TWT)$0.82-2.43% * Ondo US Dollar Yield(USDY)$1.05-0.38% * Aerodrome Finance(AERO)$0.55-4.06% * Mog Coin(MOG)$0.000001-5.82% * IoTeX(IOTX)$0.033927-2.73% * Echelon Prime(PRIME)$6.93-3.54% * Kava(KAVA)$0.293124-3.82% * Curve DAO(CRV)$0.263550-6.11% * Bitcoin Avalanche Bridged (BTC.b)(BTC.B)$57,975.00-2.04% * Amp(AMP)$0.003769-3.61% * ConstitutionDAO(PEOPLE)$0.058816-6.01% * SuperVerse(SUPER)$0.66-9.45% * Stader ETHx(ETHX)$2,551.54-3.51% * Sun Token(SUN)$0.029886-6.75% * Dash(DASH)$24.422.50% * JUST(JST)$0.028857-3.96% * 1inch(1INCH)$0.225673-4.39% * Blur(BLUR)$0.151448-2.11% * Holo(HOT)$0.001567-2.76% * PepeCoin(PEPECOIN)$2.34-4.11% * Aevo(AEVO)$0.312952-4.98% * Kusama(KSM)$17.65-4.12% * Golem(GLM)$0.271877-2.74% * WOO(WOO)$0.141050-6.16% * GMT(GMT)$0.113377-3.10% * Jito(JTO)$2.13-3.22% * Galxe(GAL)$2.08-2.06% * aelf(ELF)$0.363947-3.82% * SingularityNET(AGIX)$0.51-3.71% * Osmosis(OSMO)$0.380562-4.55% * DOG•GO•TO•THE•MOON (Runes)(DOG)$0.002583-8.44% * Arkham(ARKM)$0.98-6.18% * Reserve Rights(RSR)$0.005001-5.87% * Metaplex(MPLX)$0.259372-5.48% * Zilliqa(ZIL)$0.013272-2.00% * Aragon(ANT)$6.25-1.46% * Sundog(SUNDOG)$0.249698-1.97% * Illuvium(ILV)$36.45-4.34% * GMX(GMX)$25.40-3.04% * cWBTC(CWBTC)$1,162.57-2.01% * Venom(VENOM)$0.133300-2.66% * Dymension(DYM)$1.21-6.65% * Turbo(TURBO)$0.003505-3.82% * Basic Attention(BAT)$0.160175-3.12% * 0x Protocol(ZRX)$0.282449-3.57% * Gravity(G)$0.033083-6.98% * Radix(XRD)$0.022696-2.21% * Siacoin(SC)$0.004107-3.10% * Arbitrum Bridged USDC (Arbitrum)(USDC.E)$1.00-0.11% * Ankr Network(ANKR)$0.023473-2.91% * Terra(LUNA)$0.340719-0.41% * Memecoin(MEME)$0.009224-5.76% * Celo(CELO)$0.425758-5.32% * Manta Network(MANTA)$0.62-6.08% * Polygon Bridged WBTC (Polygon POS)(WBTC)$57,851.00-2.14% * Enjin Coin(ENJ)$0.136700-0.96% * Olympus(OHM)$14.310.05% * Qtum(QTUM)$2.19-2.94% * QuantixAI(QAI)$71.85-2.21% * OUSG(OUSG)$107.820.04% * Lombard Staked BTC(LBTC)$57,866.00-2.33% * Rocket Pool(RPL)$10.97-2.30% * Ravencoin(RVN)$0.015613-3.78% * Ether.fi(ETHFI)$1.27-4.93% * Polymesh(POLYX)$0.203657-4.13% * Flux(FLUX)$0.6315.01% * Liquid Staked ETH(LSETH)$2,593.27-3.07% * Tribe(TRIBE)$0.4765033.39% * Avail(AVAIL)$0.1236232.80% * Usual USD(USD0)$1.00-0.05% * Mask Network(MASK)$2.12-5.97% * CorgiAI(CORGIAI)$0.0006161.56% * MMX(MMX)$1.45-1.28% * Quorium(QGOLD)$2,501.34-0.30% * Ultima(ULTIMA)$6,819.623.25% * Gas(GAS)$3.16-2.99% * OriginTrail(TRAC)$0.50-3.01% * Nexus Mutual(NXM)$57.103.19% * Osaka Protocol(OSAK)$0.00000011.51% * Threshold Network(T)$0.020458-4.45% * Bitcoin(BTC)$57,892.00-2.32% * Ethereum(ETH)$2,456.78-3.47% * Tether(USDT)$1.00-0.11% * BNB(BNB)$523.74-0.80% * Solana(SOL)$129.63-3.84% * USDC(USDC)$1.00-0.09% * XRP(XRP)$0.56-0.61% * Lido Staked Ether(STETH)$2,456.17-3.45% * Dogecoin(DOGE)$0.097650-1.44% * TRON(TRX)$0.150831-2.16% * Toncoin(TON)$4.95-5.15% * Cardano(ADA)$0.322088-4.40% * Wrapped stETH(WSTETH)$2,893.77-3.43% * Wrapped Bitcoin(WBTC)$57,851.00-2.20% * Avalanche(AVAX)$21.55-4.05% * Shiba Inu(SHIB)$0.000013-3.27% * WETH(WETH)$2,457.11-3.46% * Chainlink(LINK)$10.38-3.55% * Bitcoin Cash(BCH)$312.39-3.58% * Polkadot(DOT)$4.11-2.43% * LEO Token(LEO)$5.85-0.72% * Dai(DAI)$1.00-0.06% * Litecoin(LTC)$65.00-0.66% * Uniswap(UNI)$6.12-1.38% * NEAR Protocol(NEAR)$3.78-5.55% * Wrapped eETH(WEETH)$2,570.31-3.57% * Kaspa(KAS)$0.156536-3.25% * Polygon(MATIC)$0.402428-2.27% * Internet Computer(ICP)$7.25-3.52% * Monero(XMR)$174.653.32% * Pepe(PEPE)$0.000007-3.63% * Aptos(APT)$6.15-3.64% * Artificial Superintelligence Alliance(FET)$1.13-7.54% * First Digital USD(FDUSD)$1.00-0.33% * Stellar(XLM)$0.091915-0.62% * Ethena USDe(USDE)$1.000.00% * Ethereum Classic(ETC)$17.80-2.76% * OKB(OKB)$36.25-1.59% * Sui(SUI)$0.812.74% * Stacks(STX)$1.44-4.81% * Cronos(CRO)$0.078987-2.00% * Filecoin(FIL)$3.39-3.04% * Mantle(MNT)$0.58-3.45% * Bittensor(TAO)$257.71-8.51% * Render(RENDER)$4.80-6.18% * Immutable(IMX)$1.18-7.63% * Aave(AAVE)$123.27-7.73% * Hedera(HBAR)$0.049098-3.28% * Arbitrum(ARB)$0.499695-3.56% * VeChain(VET)$0.021055-3.32% * Cosmos Hub(ATOM)$4.16-6.45% * Optimism(OP)$1.36-3.58% * Injective(INJ)$16.25-5.63% * Maker(MKR)$1,689.28-4.28% * WhiteBIT Coin(WBT)$10.86-0.15% * dogwifhat(WIF)$1.51-2.21% * Binance-Peg WETH(WETH)$2,456.63-3.59% * Arweave(AR)$20.76-4.65% * Bitget Token(BGB)$0.97-0.32% * Rocket Pool ETH(RETH)$2,750.73-3.64% * The Graph(GRT)$0.137508-5.87% * THORChain(RUNE)$3.92-0.57% * Mantle Staked Ether(METH)$2,559.29-3.54% * Helium(HNT)$7.06-7.22% * Bonk(BONK)$0.000017-3.62% * FLOKI(FLOKI)$0.000120-1.76% * Theta Network(THETA)$1.15-3.87% * Fantom(FTM)$0.396787-7.45% * Solv Protocol SolvBTC(SOLVBTC)$57,766.00-2.24% * Algorand(ALGO)$0.120891-3.71% * Gate(GT)$7.45-0.22% * KuCoin(KCS)$8.24-1.73% * Jupiter(JUP)$0.72-3.88% * Pyth Network(PYTH)$0.263015-3.76% * Renzo Restaked ETH(EZETH)$2,497.39-3.66% * PayPal USD(PYUSD)$1.000.02% * Lido DAO(LDO)$1.01-6.50% * JasmyCoin(JASMY)$0.018410-2.93% * Quant(QNT)$61.28-1.77% * Ronin Bridged WETH (Ronin)(WETH)$2,456.68-3.67% * Sei(SEI)$0.266959-6.22% * Bitcoin SV(BSV)$44.122.31% * Celestia(TIA)$4.15-7.94% * Ondo(ONDO)$0.59-5.17% * Flow(FLOW)$0.56-1.90% * ether.fi Staked ETH(EETH)$2,460.35-3.25% * Fasttoken(FTN)$2.520.13% * MANTRA(OM)$0.97-2.74% * Notcoin(NOT)$0.007948-5.98% * Core(CORE)$0.89-3.44% * BitTorrent(BTT)$0.000001-2.72% * Klaytn(KLAY)$0.131509-4.64% * USDD(USDD)$1.000.10% * MultiversX(EGLD)$26.80-5.01% * Flare(FLR)$0.015221-3.85% * EOS(EOS)$0.459284-3.54% * Brett(BRETT)$0.069590-9.49% * GALA(GALA)$0.017793-4.05% * Axie Infinity(AXS)$4.51-3.72% * NEO(NEO)$9.48-2.80% * Tokenize Xchange(TKX)$8.30-3.94% * ORDI(ORDI)$31.22-0.12% * Starknet(STRK)$0.366819-3.31% * Frax(FRAX)$1.00-0.08% * Beam(BEAM)$0.012595-6.38% * Marinade Staked SOL(MSOL)$157.41-3.70% * Kelp DAO Restaked ETH(RSETH)$2,509.58-3.77% * Tezos(XTZ)$0.63-4.48% * SATS (Ordinals)(SATS)$0.000000-4.43% * Tether Gold(XAUT)$2,494.70-0.16% * Arbitrum Bridged WBTC (Arbitrum One)(WBTC)$57,867.00-2.05% * eCash(XEC)$0.000030-1.70% * Worldcoin(WLD)$1.42-3.99% * The Sandbox(SAND)$0.244563-2.94% * Akash Network(AKT)$2.29-6.57% * Arbitrum Bridged WETH (Arbitrum One)(WETH)$2,456.42-3.54% * Ethereum Name Service(ENS)$16.86-5.02% * NEXO(NEXO)$0.98-2.48% * Conflux(CFX)$0.126135-4.26% * dYdX(DYDX)$0.88-3.39% * Popcat(POPCAT)$0.55-10.07% * Dogs(DOGS)$0.001030-11.67% * Ronin(RON)$1.51-5.16% * Wormhole(W)$0.200223-5.69% * Coinbase Wrapped Staked ETH(CBETH)$2,649.39-3.50% * TrueUSD(TUSD)$1.00-0.11% * Mina Protocol(MINA)$0.417823-5.21% * Decentraland(MANA)$0.257544-3.02% * PAX Gold(PAXG)$2,495.38-0.17% * L2 Standard Bridged WETH (Blast)(WETH)$2,467.90-2.62% * Pendle(PENDLE)$2.91-9.09% * Chiliz(CHZ)$0.050856-3.10% * Frax Ether(FRXETH)$2,450.25-3.54% * APENFT(NFT)$0.000000-8.51% * PancakeSwap(CAKE)$1.69-3.03% * Zcash(ZEC)$29.19-1.27% * Terra Luna Classic(LUNC)$0.000076-2.53% * AIOZ Network(AIOZ)$0.384239-5.64% * DeXe(DEXE)$7.48-1.63% * Synthetix Network(SNX)$1.30-2.64% * Ethena(ENA)$0.222693-6.80% * IOTA(IOTA)$0.123115-4.08% * Astar(ASTR)$0.058278-5.04% * USDB(USDB)$1.010.86% * Axelar(AXL)$0.53-1.36% * Livepeer(LPT)$11.85-6.29% * BOOK OF MEME(BOME)$0.005868-3.18% * ApeCoin(APE)$0.59-1.56% * XDC Network(XDC)$0.026105-0.19% * Raydium(RAY)$1.46-4.20% * Gnosis(GNO)$147.63-1.30% * LayerZero(ZRO)$3.39-11.07% * Bridged USDC (Polygon PoS Bridge)(USDC.E)$1.00-0.12% * Compound(COMP)$43.37-4.12% * SafePal(SFP)$0.771.30% * Bitcoin Gold(BTG)$21.39-2.38% * Polygon PoS Bridged WETH (Polygon POS)(WETH)$2,455.83-3.50% * Binance-Peg BUSD(BUSD)$1.00-0.36% * ZKsync(ZK)$0.099832-6.24% * Safe(SAFE)$0.76-3.46% * Nervos Network(CKB)$0.008070-2.56% * Staked Frax Ether(SFRXETH)$2,689.83-2.76% * MX(MX)$3.68-0.05% * L2 Standard Bridged WETH (Base)(WETH)$2,457.02-3.45% * Oasis Network(ROSE)$0.053043-4.46% * Theta Fuel(TFUEL)$0.053315-5.36% * cat in a dogs world(MEW)$0.004002-4.72% * Swell Ethereum(SWETH)$2,618.43-3.54% * WEMIX(WEMIX)$0.87-0.10% * Beldex(BDX)$0.0521210.61% * Trust Wallet(TWT)$0.82-2.43% * Ondo US Dollar Yield(USDY)$1.05-0.38% * Aerodrome Finance(AERO)$0.55-4.06% * Mog Coin(MOG)$0.000001-5.82% * IoTeX(IOTX)$0.033927-2.73% * Echelon Prime(PRIME)$6.93-3.54% * Kava(KAVA)$0.293124-3.82% * Curve DAO(CRV)$0.263550-6.11% * Bitcoin Avalanche Bridged (BTC.b)(BTC.B)$57,975.00-2.04% * Amp(AMP)$0.003769-3.61% * ConstitutionDAO(PEOPLE)$0.058816-6.01% * SuperVerse(SUPER)$0.66-9.45% * Stader ETHx(ETHX)$2,551.54-3.51% * Sun Token(SUN)$0.029886-6.75% * Dash(DASH)$24.422.50% * JUST(JST)$0.028857-3.96% * 1inch(1INCH)$0.225673-4.39% * Blur(BLUR)$0.151448-2.11% * Holo(HOT)$0.001567-2.76% * PepeCoin(PEPECOIN)$2.34-4.11% * Aevo(AEVO)$0.312952-4.98% * Kusama(KSM)$17.65-4.12% * Golem(GLM)$0.271877-2.74% * WOO(WOO)$0.141050-6.16% * GMT(GMT)$0.113377-3.10% * Jito(JTO)$2.13-3.22% * Galxe(GAL)$2.08-2.06% * aelf(ELF)$0.363947-3.82% * SingularityNET(AGIX)$0.51-3.71% * Osmosis(OSMO)$0.380562-4.55% * DOG•GO•TO•THE•MOON (Runes)(DOG)$0.002583-8.44% * Arkham(ARKM)$0.98-6.18% * Reserve Rights(RSR)$0.005001-5.87% * Metaplex(MPLX)$0.259372-5.48% * Zilliqa(ZIL)$0.013272-2.00% * Aragon(ANT)$6.25-1.46% * Sundog(SUNDOG)$0.249698-1.97% * Illuvium(ILV)$36.45-4.34% * GMX(GMX)$25.40-3.04% * cWBTC(CWBTC)$1,162.57-2.01% * Venom(VENOM)$0.133300-2.66% * Dymension(DYM)$1.21-6.65% * Turbo(TURBO)$0.003505-3.82% * Basic Attention(BAT)$0.160175-3.12% * 0x Protocol(ZRX)$0.282449-3.57% * Gravity(G)$0.033083-6.98% * Radix(XRD)$0.022696-2.21% * Siacoin(SC)$0.004107-3.10% * Arbitrum Bridged USDC (Arbitrum)(USDC.E)$1.00-0.11% * Ankr Network(ANKR)$0.023473-2.91% * Terra(LUNA)$0.340719-0.41% * Memecoin(MEME)$0.009224-5.76% * Celo(CELO)$0.425758-5.32% * Manta Network(MANTA)$0.62-6.08% * Polygon Bridged WBTC (Polygon POS)(WBTC)$57,851.00-2.14% * Enjin Coin(ENJ)$0.136700-0.96% * Olympus(OHM)$14.310.05% * Qtum(QTUM)$2.19-2.94% * QuantixAI(QAI)$71.85-2.21% * OUSG(OUSG)$107.820.04% * Lombard Staked BTC(LBTC)$57,866.00-2.33% * Rocket Pool(RPL)$10.97-2.30% * Ravencoin(RVN)$0.015613-3.78% * Ether.fi(ETHFI)$1.27-4.93% * Polymesh(POLYX)$0.203657-4.13% * Flux(FLUX)$0.6315.01% * Liquid Staked ETH(LSETH)$2,593.27-3.07% * Tribe(TRIBE)$0.4765033.39% * Avail(AVAIL)$0.1236232.80% * Usual USD(USD0)$1.00-0.05% * Mask Network(MASK)$2.12-5.97% * CorgiAI(CORGIAI)$0.0006161.56% * MMX(MMX)$1.45-1.28% * Quorium(QGOLD)$2,501.34-0.30% * Ultima(ULTIMA)$6,819.623.25% * Gas(GAS)$3.16-2.99% * OriginTrail(TRAC)$0.50-3.01% * Nexus Mutual(NXM)$57.103.19% * Osaka Protocol(OSAK)$0.00000011.51% * Threshold Network(T)$0.020458-4.45% * * * * * * * * Our Team * Contact Us * Roadmap * Disclaimer Menu * Our Team * Contact Us * Roadmap * Disclaimer Get Started * Russian * Russian HOME MCN COIN YOUR KEY TO THE WORLD OF CRYPTOCURRENCIES. Your Path to the World of Digital Assets and Blockchain Revolution. Ensure Your Financial Freedom and Innovative Opportunities in the Crypto World. Invest with Confidence in Advanced Technologies and Solutions. Get Started with MCN MCN Ecosystem Buy MCN PARTNERS MCN COIN FACTS 120K+ USERS TRADING ON MAJOR EXCHANGES INTEGRATION WITH BNB SMART CHAIN PLANNED TO BE PEGGED WITH USD PLAN TO REACH 2.5+ MILLION USERS ACTIVE COMMUNITY AND SUPPORT TECHNOLOGY FOR VERIFYING PRODUCT DELIVERY TRADING AND INVESTING TECHNICAL ANALYSIS CRYPTO Bitcoin $57,905.84 -2.24% Ethereum $2,456.03 -3.42% MCNCOIN $0.870693 -1.62% USDAUDBRLCADCLPCNYCZKDKKEURHKDHUFINRIDRILSJPYMYRMXNTWDNZDNOKPKRPHPPLNGBPRUBSGDZARKRWSEKCHFTHBTRY Powered by #CoinPriceMarketcapVolume (24h)SupplyChangeLast 24h1 Bitcoin BTC $ 58,009.00$ 1.15 T$ 27.00 B19.75 M1.82%2 Ethereum ETH $ 2,457.42$ 296.30 B$ 10.59 B120.31 M3.46%3 Tether USDT $ 0.998707$ 118.04 B$ 38.50 B118.14 B0.17%4 BNB BNB $ 524.13$ 76.60 B$ 784.18 M145.89 M0.50%5 Solana SOL $ 129.85$ 60.69 B$ 2.13 B466.70 M3.41%6 USDC USDC $ 0.998953$ 34.60 B$ 5.28 B34.62 B0.14%7 XRP XRP $ 0.56458$ 31.76 B$ 949.91 M56.25 B0.42%8 Lido Staked Ether STETH $ 2,457.13$ 24.10 B$ 36.81 M9.81 M3.42%9 Dogecoin DOGE $ 0.097567$ 14.27 B$ 430.83 M145.80 B1.40%10 TRON TRX $ 0.151038$ 13.08 B$ 467.41 M86.75 B2.38%11 Toncoin TON $ 4.96$ 12.59 B$ 372.36 M2.54 B4.63%12 Cardano ADA $ 0.322608$ 11.52 B$ 292.99 M35.65 B4.19%13 Wrapped stETH WSTETH $ 2,898.01$ 10.17 B$ 101.25 M3.50 M3.28%15 Avalanche AVAX $ 21.55$ 8.74 B$ 213.51 M405.18 M4.00%14 Wrapped Bitcoin WBTC $ 57,952.00$ 8.88 B$ 127.22 M153.17 K1.89%16 Shiba Inu SHIB $ 0.000013$ 7.82 B$ 203.66 M589.26 T3.10% Coins per page: 102550100 Previous1 - 16 of 16Next THE EVOLUTION OF FINANCE The financial landscape is undergoing revolutionary changes with the emergence of cryptocurrencies, which offer unprecedented opportunities for economic inclusivity and innovation. MCN Coin is at the forefront of these changes, providing a reliable and accessible cryptocurrency platform designed for both experienced crypto enthusiasts and newcomers. By leveraging the advanced technology of BNB Smart Chain, MCN Coin ensures fast, secure, and transparent transactions that facilitate seamless participation in the global digital economy. BACKGROUND The concept of cryptocurrency is transforming traditional financial systems by introducing decentralized and secure ways to conduct transactions. MCN Coin, using blockchain technology, offers a unique platform that not only promises economic benefits but also aims to provide social empowerment, especially for unbanked individuals and migrant communities. Read White Paper * Advantages * How to Use ADVANTAGES OF MCN 1. Trading and Investing: “MCNcoin” is a favored tool among traders, allowing them to quickly and efficiently fund exchanges without leaving the cryptocurrency market. 2. Money Transfers: “MCNcoin” provides a stable rate, allowing investors and migrants to preserve their funds. It simplifies international transfers, especially to remote areas, with minimal fees. Recipients can convert “MCNcoin” to local currency or use it directly. 3. Earning Interest: “MCNcoin” offers higher interest rates compared to banks while maintaining the liquidity and stability of the “MCNcoin” token. 4. Payment for Goods and Services: Many retailers and restaurants already accept “MCNcoin,” and exchange points conduct transactions with it. “MCNcoin” is especially useful for international transactions and migrant transfers, bypassing costly and complex banking procedures. 5. Participation in DeFi: “MCNcoin” is actively used in decentralized finance (DeFi) for lending, borrowing, and earning through various protocols. Its low volatility makes it an attractive and less risky asset for participating in DeFi projects. 6. Storage in Crypto Wallets: Offers investors a choice between hot and cold crypto wallets for secure storage. HOW TO USE MCN 1. Payments and Transactions: MCN can be used for making payments for goods and services, both online and in the real world, if local vendors accept this cryptocurrency. 2. Investments and Trading: As a cryptocurrency token, MCN can be used for investing and trading on cryptocurrency exchanges. 3. Participation in Projects and Ecosystems: Some projects may use MCN as a means of participation or voting. For example, token holders may gain access to additional features or benefits within the ecosystem supporting MCN. 4. Supporting Developers and the Community: Through donations or purchasing goods and services offered by developers and community members, you can support the further development of projects utilizing MCN. 5. NFTs and Digital Assets: MCN can be associated with the buying and selling of digital assets, such as NFTs (non-fungible tokens), which represent unique digital objects or art. VISION AND MISSION 1. VISION: MCN Coin aims to redefine the Central Asian market by providing a stable, secure, and convenient platform that meets the financial needs of both individuals and businesses in Central Asia and beyond. Our vision is to drive economic growth and financial inclusivity through cutting-edge technology and strategic partnerships. 2. MISSION: The global cryptocurrency market is expanding rapidly, with increasing numbers of users and transactions each year. Cryptocurrencies have gained popularity as alternative investment tools and means of exchange. According to the latest market analysis, the market is expected to grow at a compound annual growth rate (CAGR) of 12.8% from 2023 to 2030. MARKET OVERVIEW GLOBAL CRYPTOCURRENCY MARKET The global cryptocurrency market is expanding rapidly, with increasing numbers of users and transactions each year. Cryptocurrencies have gained popularity as alternative investment tools and means of exchange. According to the latest market analysis, the market is expected to grow at a compound annual growth rate (CAGR) of 12.8% from 2023 to 2030. * Market Growth and Evolution * Trends and Innovations: * Regional Differences: The historical development of cryptocurrencies and their impact on financial markets. The effect of major events (e.g., adoption of cryptocurrencies by central banks) on the market. Growing attention to DeFi (decentralized finance) and NFTs (non-fungible tokens). Trends in cryptocurrency regulation and legal aspects. Market characteristics in North America, Europe, Asia, and other regions. The impact of local economic conditions on the adoption and use of cryptocurrencies. MARKET CONTEXT OF CENTRAL ASIA Central Asia presents a unique case where cryptocurrency has been adopted as a legal means of payment, creating a testing ground for widespread cryptocurrency adoption. This move positions Central Asia as a leader in the Central Asian digital currency market and provides MCN Coin with fertile ground for expanding its user base and practical application. * Legal Regulation and Adoption * Technical Infrastructure * Economic Impact The Central Asia government’s policy on cryptocurrencies. How the legalization of cryptocurrencies affects the market and business. The level of development of blockchain technology and cryptocurrency infrastructure in the country. Key players and platforms supporting cryptocurrency transactions. The Central Asia government’s policy on cryptocurrencies. How the legalization of cryptocurrencies affects the market and business. MONEY TRANSFERS AND MIGRANTS The money transfer market is critically important for many developing economies. With over 1.2 million Central Asia migrants abroad, MCN Coin has a strong chance to capture a significant share of this market by offering a cost-effective and reliable solution for international transactions. * Cryptocurrency Solutions for Transfers: * Money Transfer Market Analysis * Migrants' Needs and Profiles How MCN Coin can improve the money transfer process. Benefits of using cryptocurrencies for migrants (e.g., lower fees, transaction speed). The Kyrgyz government’s policy on cryptocurrencies. How the legalization of cryptocurrencies affects the market and business. Key needs of migrants in money transfers and how they are met. Examples of successful use cases of cryptocurrencies for money transfers among migrants. DISCOVER FREEDOM WITH MCN COIN (MCN) In conclusion, the “MCN Coin” token represents an innovative solution in the world of cryptocurrencies, offering a unique blend of stability, transparency, and technological advancement. Utilizing the BNB Smart Chain blockchain and plans for conversion into a stablecoin, “MCNcoin” provides users with a high level of security and reliability, minimizing volatility risks and ensuring transaction accessibility worldwide. CONCLUSION MCN Coin is poised to revolutionize the way individuals and businesses interact with digital currencies. With a solid foundation, legal recognition, and strategic vision, MCN Coin is well-positioned to achieve its ambitious goals and make a lasting impact on the global financial landscape. We invite you to join us on this exciting journey towards a more inclusive and prosperous future. USEFUL LINKS * White Paper * Our Team * Contact Us * Roadmap * Disclaimer INFORMATION * info@mcncoin.co * +996 707 300 186 © 2024 MCN COIN. All Rights Reserved. Designed By 360 Global Services